C26H24O4 — CID 101479389
(Z,5S)-3-methoxy-4-oxo-5-trityloxyhex-2-enal (PubChem CID 101479389) has the molecular formula C26H24O4 and a molecular weight of 400.47 g/mol. Its IUPAC name is (Z,5S)-3-methoxy-4-oxo-5-trityloxyhex-2-enal.
| Compound Name | (Z,5S)-3-methoxy-4-oxo-5-trityloxyhex-2-enal |
|---|---|
| PubChem CID | 101479389 |
| Molecular Formula | C26H24O4 |
| Molecular Weight | 400.47 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | (Z,5S)-3-methoxy-4-oxo-5-trityloxyhex-2-enal |
| SMILES | CO/C(=C\C=O)C(=O)[C@H](C)OC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H24O4/c1-20(25(28)24(29-2)18-19-27)30-26(21-12-6-3-7-13-21,22-14-8-4-9-15-22)23-16-10-5-11-17-23/h3-20H,1-2H3/b24-18-/t20-/m0/s1 |
| InChIKey | WCQNBIFAAJBZHA-JHMOUWFPSA-N |
| XLogP | 4.68 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.47 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|