About (2S)-2-trityloxypropanal
(2S)-2-trityloxypropanal (PubChem CID 11834057) has the molecular formula C22H20O2
and a molecular weight of 316.40 g/mol. Its IUPAC name is (2S)-2-trityloxypropanal.
Molecular Properties
| Compound Name | (2S)-2-trityloxypropanal |
| PubChem CID | 11834057 |
| Molecular Formula | C22H20O2 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | (2S)-2-trityloxypropanal |
| SMILES | C[C@@H](C=O)OC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H20O2/c1-18(17-23)24-22(19-11-5-2-6-12-19,20-13-7-3-8-14-20)21-15-9-4-10-16-21/h2-18H,1H3/t18-/m0/s1 |
| InChIKey | JZBRSHYLBVFLLL-SFHVURJKSA-N |
| XLogP | 4.58 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-trityloxypropanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-trityloxypropanal?
The IUPAC name of (2S)-2-trityloxypropanal (CID 11834057) is (2S)-2-trityloxypropanal.
What is the SMILES notation for (2S)-2-trityloxypropanal?
The canonical SMILES for (2S)-2-trityloxypropanal is C[C@@H](C=O)OC(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of (2S)-2-trityloxypropanal?
The InChIKey is JZBRSHYLBVFLLL-SFHVURJKSA-N. The full InChI is InChI=1S/C22H20O2/c1-18(17-23)24-22(19-11-5-2-6-12-19,20-13-7-3-8-14-20)21-15-9-4-10-16-21/h2-18H,1H3/t18-/m0/s1.
What are the key properties of (2S)-2-trityloxypropanal?
(2S)-2-trityloxypropanal has a molecular weight of 316.40 g/mol, XLogP of 4.58, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-trityloxypropanal is sourced from PubChem (CID 11834057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).