C14H19NO5 — CID 77323942
3-amino-2-hydroxy-4-[(2-methylpropan-2-yl)oxy]-4-oxo-3-phenylbutanoic acid (PubChem CID 77323942) has the molecular formula C14H19NO5 and a molecular weight of 281.31 g/mol. Its IUPAC name is 3-amino-2-hydroxy-4-[(2-methylpropan-2-yl)oxy]-4-oxo-3-phenylbutanoic acid.
| Compound Name | 3-amino-2-hydroxy-4-[(2-methylpropan-2-yl)oxy]-4-oxo-3-phenylbutanoic acid |
|---|---|
| PubChem CID | 77323942 |
| Molecular Formula | C14H19NO5 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | 3-amino-2-hydroxy-4-[(2-methylpropan-2-yl)oxy]-4-oxo-3-phenylbutanoic acid |
| SMILES | CC(C)(C)OC(=O)C(N)(c1ccccc1)C(O)C(=O)O |
| InChI | InChI=1S/C14H19NO5/c1-13(2,3)20-12(19)14(15,10(16)11(17)18)9-7-5-4-6-8-9/h4-8,10,16H,15H2,1-3H3,(H,17,18) |
| InChIKey | YGPZJESERIZNIY-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |