C14H21NO4S — CID 67941966
tert-butyl 2-amino-3-methylsulfonyl-2-phenylpropanoate (PubChem CID 67941966) has the molecular formula C14H21NO4S and a molecular weight of 299.39 g/mol. Its IUPAC name is tert-butyl 2-amino-3-methylsulfonyl-2-phenylpropanoate.
| Compound Name | tert-butyl 2-amino-3-methylsulfonyl-2-phenylpropanoate |
|---|---|
| PubChem CID | 67941966 |
| Molecular Formula | C14H21NO4S |
| Molecular Weight | 299.39 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | tert-butyl 2-amino-3-methylsulfonyl-2-phenylpropanoate |
| SMILES | CC(C)(C)OC(=O)C(N)(CS(C)(=O)=O)c1ccccc1 |
| InChI | InChI=1S/C14H21NO4S/c1-13(2,3)19-12(16)14(15,10-20(4,17)18)11-8-6-5-7-9-11/h5-9H,10,15H2,1-4H3 |
| InChIKey | IWKMRFXSTSNAMO-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.39 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |