C15H23NO5S — CID 87270659
tert-butyl (2S)-2-amino-4-methylsulfonyloxy-2-phenylbutanoate (PubChem CID 87270659) has the molecular formula C15H23NO5S and a molecular weight of 329.42 g/mol. Its IUPAC name is tert-butyl (2S)-2-amino-4-methylsulfonyloxy-2-phenylbutanoate.
| Compound Name | tert-butyl (2S)-2-amino-4-methylsulfonyloxy-2-phenylbutanoate |
|---|---|
| PubChem CID | 87270659 |
| Molecular Formula | C15H23NO5S |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | tert-butyl (2S)-2-amino-4-methylsulfonyloxy-2-phenylbutanoate |
| SMILES | CC(C)(C)OC(=O)[C@](N)(CCOS(C)(=O)=O)c1ccccc1 |
| InChI | InChI=1S/C15H23NO5S/c1-14(2,3)21-13(17)15(16,10-11-20-22(4,18)19)12-8-6-5-7-9-12/h5-9H,10-11,16H2,1-4H3/t15-/m0/s1 |
| InChIKey | ADQDUKWJBXJEMZ-HNNXBMFYSA-N |
| XLogP | 1.55 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|