C18H20O2 — CID 100923277
3-methoxy-2,2-dimethyl-1,3-diphenylpropan-1-one (PubChem CID 100923277) has the molecular formula C18H20O2 and a molecular weight of 268.36 g/mol. Its IUPAC name is 3-methoxy-2,2-dimethyl-1,3-diphenylpropan-1-one.
| Compound Name | 3-methoxy-2,2-dimethyl-1,3-diphenylpropan-1-one |
|---|---|
| PubChem CID | 100923277 |
| Molecular Formula | C18H20O2 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | 3-methoxy-2,2-dimethyl-1,3-diphenylpropan-1-one |
| SMILES | COC(c1ccccc1)C(C)(C)C(=O)c1ccccc1 |
| InChI | InChI=1S/C18H20O2/c1-18(2,16(19)14-10-6-4-7-11-14)17(20-3)15-12-8-5-9-13-15/h4-13,17H,1-3H3 |
| InChIKey | GHPDVIPRCABJAU-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |