C23H30O3 — CID 139502993
bis(2,2-dimethyl-1-phenylpropyl) carbonate (PubChem CID 139502993) has the molecular formula C23H30O3 and a molecular weight of 354.49 g/mol. Its IUPAC name is bis(2,2-dimethyl-1-phenylpropyl) carbonate.
| Compound Name | bis(2,2-dimethyl-1-phenylpropyl) carbonate |
|---|---|
| PubChem CID | 139502993 |
| Molecular Formula | C23H30O3 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | bis(2,2-dimethyl-1-phenylpropyl) carbonate |
| SMILES | CC(C)(C)C(OC(=O)OC(c1ccccc1)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C23H30O3/c1-22(2,3)19(17-13-9-7-10-14-17)25-21(24)26-20(23(4,5)6)18-15-11-8-12-16-18/h7-16,19-20H,1-6H3 |
| InChIKey | LDRGTQKZEXERCY-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |