C11H15NO2Si — CID 139777207
(2,2-dimethyl-1-phenylpropoxy)imino-oxosilane (PubChem CID 139777207) has the molecular formula C11H15NO2Si and a molecular weight of 221.33 g/mol. Its IUPAC name is (2,2-dimethyl-1-phenylpropoxy)imino-oxosilane.
| Compound Name | (2,2-dimethyl-1-phenylpropoxy)imino-oxosilane |
|---|---|
| PubChem CID | 139777207 |
| Molecular Formula | C11H15NO2Si |
| Molecular Weight | 221.33 g/mol |
| Exact Mass | 221.09 |
| IUPAC Name | (2,2-dimethyl-1-phenylpropoxy)imino-oxosilane |
| SMILES | CC(C)(C)C(ON=[Si]=O)c1ccccc1 |
| InChI | InChI=1S/C11H15NO2Si/c1-11(2,3)10(14-12-15-13)9-7-5-4-6-8-9/h4-8,10H,1-3H3 |
| InChIKey | MILNEBDERSWTDC-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.33 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|