About 1-phenylethyl nitrite
1-phenylethyl nitrite (PubChem CID 18989891) has the molecular formula C8H9NO2
and a molecular weight of 151.16 g/mol. Its IUPAC name is 1-phenylethyl nitrite.
Molecular Properties
| Compound Name | 1-phenylethyl nitrite |
| PubChem CID | 18989891 |
| Molecular Formula | C8H9NO2 |
| Molecular Weight | 151.16 g/mol |
| Exact Mass | 151.06 |
| IUPAC Name | 1-phenylethyl nitrite |
| SMILES | CC(ON=O)c1ccccc1 |
| InChI | InChI=1S/C8H9NO2/c1-7(11-9-10)8-5-3-2-4-6-8/h2-7H,1H3 |
| InChIKey | YIHYSPHLIOTYAG-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.16 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-phenylethyl nitrite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenylethyl nitrite?
The IUPAC name of 1-phenylethyl nitrite (CID 18989891) is 1-phenylethyl nitrite.
What is the SMILES notation for 1-phenylethyl nitrite?
The canonical SMILES for 1-phenylethyl nitrite is CC(ON=O)c1ccccc1.
What is the InChIKey of 1-phenylethyl nitrite?
The InChIKey is YIHYSPHLIOTYAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO2/c1-7(11-9-10)8-5-3-2-4-6-8/h2-7H,1H3.
What are the key properties of 1-phenylethyl nitrite?
1-phenylethyl nitrite has a molecular weight of 151.16 g/mol, XLogP of 2.45, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylethyl nitrite is sourced from PubChem (CID 18989891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).