C16H19Cl2NO4 — CID 10247919
(4-acetamido-2,2-dichloro-4-methyl-3-oxo-1-phenylpentyl) acetate (PubChem CID 10247919) has the molecular formula C16H19Cl2NO4 and a molecular weight of 360.24 g/mol. Its IUPAC name is (4-acetamido-2,2-dichloro-4-methyl-3-oxo-1-phenylpentyl) acetate.
| Compound Name | (4-acetamido-2,2-dichloro-4-methyl-3-oxo-1-phenylpentyl) acetate |
|---|---|
| PubChem CID | 10247919 |
| Molecular Formula | C16H19Cl2NO4 |
| Molecular Weight | 360.24 g/mol |
| Exact Mass | 359.07 |
| IUPAC Name | (4-acetamido-2,2-dichloro-4-methyl-3-oxo-1-phenylpentyl) acetate |
| SMILES | CC(=O)NC(C)(C)C(=O)C(Cl)(Cl)C(OC(C)=O)c1ccccc1 |
| InChI | InChI=1S/C16H19Cl2NO4/c1-10(20)19-15(3,4)14(22)16(17,18)13(23-11(2)21)12-8-6-5-7-9-12/h5-9,13H,1-4H3,(H,19,20) |
| InChIKey | WIRFAORNXCGNCC-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.24 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|