C15H17F2NO3 — CID 86073329
(2,2-difluoro-3-oxo-1-phenyl-3-pyrrolidin-1-ylpropyl) acetate (PubChem CID 86073329) has the molecular formula C15H17F2NO3 and a molecular weight of 297.30 g/mol. Its IUPAC name is (2,2-difluoro-3-oxo-1-phenyl-3-pyrrolidin-1-ylpropyl) acetate.
| Compound Name | (2,2-difluoro-3-oxo-1-phenyl-3-pyrrolidin-1-ylpropyl) acetate |
|---|---|
| PubChem CID | 86073329 |
| Molecular Formula | C15H17F2NO3 |
| Molecular Weight | 297.30 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | (2,2-difluoro-3-oxo-1-phenyl-3-pyrrolidin-1-ylpropyl) acetate |
| SMILES | CC(=O)OC(c1ccccc1)C(F)(F)C(=O)N1CCCC1 |
| InChI | InChI=1S/C15H17F2NO3/c1-11(19)21-13(12-7-3-2-4-8-12)15(16,17)14(20)18-9-5-6-10-18/h2-4,7-8,13H,5-6,9-10H2,1H3 |
| InChIKey | LVXWBFWXDGEDPE-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.30 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |