C15H18F3NO2 — CID 156905517
(3,3,3-trifluoro-2-phenylpropyl) piperidine-1-carboxylate (PubChem CID 156905517) has the molecular formula C15H18F3NO2 and a molecular weight of 301.31 g/mol. Its IUPAC name is (3,3,3-trifluoro-2-phenylpropyl) piperidine-1-carboxylate.
| Compound Name | (3,3,3-trifluoro-2-phenylpropyl) piperidine-1-carboxylate |
|---|---|
| PubChem CID | 156905517 |
| Molecular Formula | C15H18F3NO2 |
| Molecular Weight | 301.31 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | (3,3,3-trifluoro-2-phenylpropyl) piperidine-1-carboxylate |
| SMILES | O=C(OCC(c1ccccc1)C(F)(F)F)N1CCCCC1 |
| InChI | InChI=1S/C15H18F3NO2/c16-15(17,18)13(12-7-3-1-4-8-12)11-21-14(20)19-9-5-2-6-10-19/h1,3-4,7-8,13H,2,5-6,9-11H2 |
| InChIKey | AJXKJLWXJNMSFF-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.31 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |