C17H17F3N2O2 — CID 98361679
(2S,5S)-6,6,6-trifluoro-3-oxo-5-phenyl-2-(pyrrolidine-1-carbonyl)hexanenitrile (PubChem CID 98361679) has the molecular formula C17H17F3N2O2 and a molecular weight of 338.33 g/mol. Its IUPAC name is (2S,5S)-6,6,6-trifluoro-3-oxo-5-phenyl-2-(pyrrolidine-1-carbonyl)hexanenitrile.
| Compound Name | (2S,5S)-6,6,6-trifluoro-3-oxo-5-phenyl-2-(pyrrolidine-1-carbonyl)hexanenitrile |
|---|---|
| PubChem CID | 98361679 |
| Molecular Formula | C17H17F3N2O2 |
| Molecular Weight | 338.33 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | (2S,5S)-6,6,6-trifluoro-3-oxo-5-phenyl-2-(pyrrolidine-1-carbonyl)hexanenitrile |
| SMILES | N#C[C@@H](C(=O)C[C@@H](c1ccccc1)C(F)(F)F)C(=O)N1CCCC1 |
| InChI | InChI=1S/C17H17F3N2O2/c18-17(19,20)14(12-6-2-1-3-7-12)10-15(23)13(11-21)16(24)22-8-4-5-9-22/h1-3,6-7,13-14H,4-5,8-10H2/t13-,14-/m0/s1 |
| InChIKey | PYPUQLLKWOYTKB-KBPBESRZSA-N |
| XLogP | 3.05 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.33 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|