C22H22N2O2 — CID 51086285
3-oxo-5,5-diphenyl-2-(pyrrolidine-1-carbonyl)pentanenitrile (PubChem CID 51086285) has the molecular formula C22H22N2O2 and a molecular weight of 346.43 g/mol. Its IUPAC name is 3-oxo-5,5-diphenyl-2-(pyrrolidine-1-carbonyl)pentanenitrile.
| Compound Name | 3-oxo-5,5-diphenyl-2-(pyrrolidine-1-carbonyl)pentanenitrile |
|---|---|
| PubChem CID | 51086285 |
| Molecular Formula | C22H22N2O2 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | 3-oxo-5,5-diphenyl-2-(pyrrolidine-1-carbonyl)pentanenitrile |
| SMILES | N#CC(C(=O)CC(c1ccccc1)c1ccccc1)C(=O)N1CCCC1 |
| InChI | InChI=1S/C22H22N2O2/c23-16-20(22(26)24-13-7-8-14-24)21(25)15-19(17-9-3-1-4-10-17)18-11-5-2-6-12-18/h1-6,9-12,19-20H,7-8,13-15H2 |
| InChIKey | MRWRRFJUIRSVNM-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|