C13H15F3N2O7S — CID 161270693
[nitro(phenyl)methyl] pyrrolidine-1-carboxylate;trifluoromethanesulfonic acid (PubChem CID 161270693) has the molecular formula C13H15F3N2O7S and a molecular weight of 400.33 g/mol. Its IUPAC name is [nitro(phenyl)methyl] pyrrolidine-1-carboxylate;trifluoromethanesulfonic acid.
| Compound Name | [nitro(phenyl)methyl] pyrrolidine-1-carboxylate;trifluoromethanesulfonic acid |
|---|---|
| PubChem CID | 161270693 |
| Molecular Formula | C13H15F3N2O7S |
| Molecular Weight | 400.33 g/mol |
| Exact Mass | 400.06 |
| IUPAC Name | [nitro(phenyl)methyl] pyrrolidine-1-carboxylate;trifluoromethanesulfonic acid |
| SMILES | O=C(OC(c1ccccc1)[N+](=O)[O-])N1CCCC1.O=S(=O)(O)C(F)(F)F |
| InChI | InChI=1S/C12H14N2O4.CHF3O3S/c15-12(13-8-4-5-9-13)18-11(14(16)17)10-6-2-1-3-7-10;2-1(3,4)8(5,6)7/h1-3,6-7,11H,4-5,8-9H2;(H,5,6,7) |
| InChIKey | VDTUNMFPDDUQDT-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 127.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.33 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|