C17H21N3O6S — CID 15142116
2-(2-nitrophenyl)sulfonyl-1,3-dipyrrolidin-1-ylpropane-1,3-dione (PubChem CID 15142116) has the molecular formula C17H21N3O6S and a molecular weight of 395.44 g/mol. Its IUPAC name is 2-(2-nitrophenyl)sulfonyl-1,3-dipyrrolidin-1-ylpropane-1,3-dione.
| Compound Name | 2-(2-nitrophenyl)sulfonyl-1,3-dipyrrolidin-1-ylpropane-1,3-dione |
|---|---|
| PubChem CID | 15142116 |
| Molecular Formula | C17H21N3O6S |
| Molecular Weight | 395.44 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | 2-(2-nitrophenyl)sulfonyl-1,3-dipyrrolidin-1-ylpropane-1,3-dione |
| SMILES | O=C(C(C(=O)N1CCCC1)S(=O)(=O)c1ccccc1[N+](=O)[O-])N1CCCC1 |
| InChI | InChI=1S/C17H21N3O6S/c21-16(18-9-3-4-10-18)15(17(22)19-11-5-6-12-19)27(25,26)14-8-2-1-7-13(14)20(23)24/h1-2,7-8,15H,3-6,9-12H2 |
| InChIKey | LJXBCEQBIUNXAX-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 117.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.44 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|