C19H20N2O4 — CID 7697246
(2S)-2-(2-nitrophenoxy)-2-phenyl-1-piperidin-1-ylethanone (PubChem CID 7697246) has the molecular formula C19H20N2O4 and a molecular weight of 340.38 g/mol. Its IUPAC name is (2S)-2-(2-nitrophenoxy)-2-phenyl-1-piperidin-1-ylethanone.
| Compound Name | (2S)-2-(2-nitrophenoxy)-2-phenyl-1-piperidin-1-ylethanone |
|---|---|
| PubChem CID | 7697246 |
| Molecular Formula | C19H20N2O4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | (2S)-2-(2-nitrophenoxy)-2-phenyl-1-piperidin-1-ylethanone |
| SMILES | O=C([C@@H](Oc1ccccc1[N+](=O)[O-])c1ccccc1)N1CCCCC1 |
| InChI | InChI=1S/C19H20N2O4/c22-19(20-13-7-2-8-14-20)18(15-9-3-1-4-10-15)25-17-12-6-5-11-16(17)21(23)24/h1,3-6,9-12,18H,2,7-8,13-14H2/t18-/m0/s1 |
| InChIKey | DWJKXXBDUNCSRW-SFHVURJKSA-N |
| XLogP | 3.73 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|