C19H20N2O3 — CID 8001851
2-[(1R)-2-oxo-1-phenyl-2-pyrrolidin-1-ylethoxy]benzamide (PubChem CID 8001851) has the molecular formula C19H20N2O3 and a molecular weight of 324.38 g/mol. Its IUPAC name is 2-[(1R)-2-oxo-1-phenyl-2-pyrrolidin-1-ylethoxy]benzamide.
| Compound Name | 2-[(1R)-2-oxo-1-phenyl-2-pyrrolidin-1-ylethoxy]benzamide |
|---|---|
| PubChem CID | 8001851 |
| Molecular Formula | C19H20N2O3 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | 2-[(1R)-2-oxo-1-phenyl-2-pyrrolidin-1-ylethoxy]benzamide |
| SMILES | NC(=O)c1ccccc1O[C@@H](C(=O)N1CCCC1)c1ccccc1 |
| InChI | InChI=1S/C19H20N2O3/c20-18(22)15-10-4-5-11-16(15)24-17(14-8-2-1-3-9-14)19(23)21-12-6-7-13-21/h1-5,8-11,17H,6-7,12-13H2,(H2,20,22)/t17-/m1/s1 |
| InChIKey | NUXBWESAKRUVBA-QGZVFWFLSA-N |
| XLogP | 2.53 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |