C18H17BrClNO2 — CID 7700719
(2R)-2-(4-bromo-2-chlorophenoxy)-2-phenyl-1-pyrrolidin-1-ylethanone (PubChem CID 7700719) has the molecular formula C18H17BrClNO2 and a molecular weight of 394.70 g/mol. Its IUPAC name is (2R)-2-(4-bromo-2-chlorophenoxy)-2-phenyl-1-pyrrolidin-1-ylethanone.
| Compound Name | (2R)-2-(4-bromo-2-chlorophenoxy)-2-phenyl-1-pyrrolidin-1-ylethanone |
|---|---|
| PubChem CID | 7700719 |
| Molecular Formula | C18H17BrClNO2 |
| Molecular Weight | 394.70 g/mol |
| Exact Mass | 393.01 |
| IUPAC Name | (2R)-2-(4-bromo-2-chlorophenoxy)-2-phenyl-1-pyrrolidin-1-ylethanone |
| SMILES | O=C([C@H](Oc1ccc(Br)cc1Cl)c1ccccc1)N1CCCC1 |
| InChI | InChI=1S/C18H17BrClNO2/c19-14-8-9-16(15(20)12-14)23-17(13-6-2-1-3-7-13)18(22)21-10-4-5-11-21/h1-3,6-9,12,17H,4-5,10-11H2/t17-/m1/s1 |
| InChIKey | MGIIUPANEPHSEK-QGZVFWFLSA-N |
| XLogP | 4.84 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.70 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |