C23H26N4O8 — CID 4981274
2-(2-nitrophenoxy)-1-[4-[2-(2-nitrophenoxy)propanoyl]-1,4-diazepan-1-yl]propan-1-one (PubChem CID 4981274) has the molecular formula C23H26N4O8 and a molecular weight of 486.48 g/mol. Its IUPAC name is 2-(2-nitrophenoxy)-1-[4-[2-(2-nitrophenoxy)propanoyl]-1,4-diazepan-1-yl]propan-1-one.
| Compound Name | 2-(2-nitrophenoxy)-1-[4-[2-(2-nitrophenoxy)propanoyl]-1,4-diazepan-1-yl]propan-1-one |
|---|---|
| PubChem CID | 4981274 |
| Molecular Formula | C23H26N4O8 |
| Molecular Weight | 486.48 g/mol |
| Exact Mass | 486.18 |
| IUPAC Name | 2-(2-nitrophenoxy)-1-[4-[2-(2-nitrophenoxy)propanoyl]-1,4-diazepan-1-yl]propan-1-one |
| SMILES | CC(Oc1ccccc1[N+](=O)[O-])C(=O)N1CCCN(C(=O)C(C)Oc2ccccc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C23H26N4O8/c1-16(34-20-10-5-3-8-18(20)26(30)31)22(28)24-12-7-13-25(15-14-24)23(29)17(2)35-21-11-6-4-9-19(21)27(32)33/h3-6,8-11,16-17H,7,12-15H2,1-2H3 |
| InChIKey | TUSNOLWKZHJBJF-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 145.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.48 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|