C16H7F2I5O4 — CID 156523244
2,2-difluoro-3-(2,3,4,5,6-pentaiodobenzoyl)oxy-3-phenylpropanoic acid (PubChem CID 156523244) has the molecular formula C16H7F2I5O4 and a molecular weight of 935.74 g/mol. Its IUPAC name is 2,2-difluoro-3-(2,3,4,5,6-pentaiodobenzoyl)oxy-3-phenylpropanoic acid.
| Compound Name | 2,2-difluoro-3-(2,3,4,5,6-pentaiodobenzoyl)oxy-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 156523244 |
| Molecular Formula | C16H7F2I5O4 |
| Molecular Weight | 935.74 g/mol |
| Exact Mass | 935.55 |
| IUPAC Name | 2,2-difluoro-3-(2,3,4,5,6-pentaiodobenzoyl)oxy-3-phenylpropanoic acid |
| SMILES | O=C(OC(c1ccccc1)C(F)(F)C(=O)O)c1c(I)c(I)c(I)c(I)c1I |
| InChI | InChI=1S/C16H7F2I5O4/c17-16(18,15(25)26)13(6-4-2-1-3-5-6)27-14(24)7-8(19)10(21)12(23)11(22)9(7)20/h1-5,13H,(H,25,26) |
| InChIKey | XPVOZUHNZPCDQP-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 935.74 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|