C16H14F2O3 — CID 139665547
2,2-difluoro-3-phenyl-3-phenylmethoxypropanoic acid (PubChem CID 139665547) has the molecular formula C16H14F2O3 and a molecular weight of 292.28 g/mol. Its IUPAC name is 2,2-difluoro-3-phenyl-3-phenylmethoxypropanoic acid.
| Compound Name | 2,2-difluoro-3-phenyl-3-phenylmethoxypropanoic acid |
|---|---|
| PubChem CID | 139665547 |
| Molecular Formula | C16H14F2O3 |
| Molecular Weight | 292.28 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | 2,2-difluoro-3-phenyl-3-phenylmethoxypropanoic acid |
| SMILES | O=C(O)C(F)(F)C(OCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H14F2O3/c17-16(18,15(19)20)14(13-9-5-2-6-10-13)21-11-12-7-3-1-4-8-12/h1-10,14H,11H2,(H,19,20) |
| InChIKey | JQKPKAMJIFNOSA-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.28 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |