C18H17F3O3 — CID 10925783
ethyl 2,2-difluoro-3-(4-fluorophenyl)-3-phenylmethoxypropanoate (PubChem CID 10925783) has the molecular formula C18H17F3O3 and a molecular weight of 338.33 g/mol. Its IUPAC name is ethyl 2,2-difluoro-3-(4-fluorophenyl)-3-phenylmethoxypropanoate.
| Compound Name | ethyl 2,2-difluoro-3-(4-fluorophenyl)-3-phenylmethoxypropanoate |
|---|---|
| PubChem CID | 10925783 |
| Molecular Formula | C18H17F3O3 |
| Molecular Weight | 338.33 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | ethyl 2,2-difluoro-3-(4-fluorophenyl)-3-phenylmethoxypropanoate |
| SMILES | CCOC(=O)C(F)(F)C(OCc1ccccc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H17F3O3/c1-2-23-17(22)18(20,21)16(14-8-10-15(19)11-9-14)24-12-13-6-4-3-5-7-13/h3-11,16H,2,12H2,1H3 |
| InChIKey | ZAXXLPXAJFTJKM-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.33 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |