C19H19F3O2 — CID 15856347
(1R,3R)-2,2-difluoro-1-(4-fluorophenyl)-1-phenylmethoxyhex-5-en-3-ol (PubChem CID 15856347) has the molecular formula C19H19F3O2 and a molecular weight of 336.35 g/mol. Its IUPAC name is (1R,3R)-2,2-difluoro-1-(4-fluorophenyl)-1-phenylmethoxyhex-5-en-3-ol.
| Compound Name | (1R,3R)-2,2-difluoro-1-(4-fluorophenyl)-1-phenylmethoxyhex-5-en-3-ol |
|---|---|
| PubChem CID | 15856347 |
| Molecular Formula | C19H19F3O2 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | (1R,3R)-2,2-difluoro-1-(4-fluorophenyl)-1-phenylmethoxyhex-5-en-3-ol |
| SMILES | C=CC[C@@H](O)C(F)(F)[C@H](OCc1ccccc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H19F3O2/c1-2-6-17(23)19(21,22)18(15-9-11-16(20)12-10-15)24-13-14-7-4-3-5-8-14/h2-5,7-12,17-18,23H,1,6,13H2/t17-,18-/m1/s1 |
| InChIKey | AZSNZWRELBRHJP-QZTJIDSGSA-N |
| XLogP | 4.66 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|