C12H13F3O — CID 3560123
(1-but-3-enoxy-2,2,2-trifluoroethyl)benzene (PubChem CID 3560123) has the molecular formula C12H13F3O and a molecular weight of 230.23 g/mol. Its IUPAC name is (1-but-3-enoxy-2,2,2-trifluoroethyl)benzene.
| Compound Name | (1-but-3-enoxy-2,2,2-trifluoroethyl)benzene |
|---|---|
| PubChem CID | 3560123 |
| Molecular Formula | C12H13F3O |
| Molecular Weight | 230.23 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | (1-but-3-enoxy-2,2,2-trifluoroethyl)benzene |
| SMILES | C=CCCOC(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C12H13F3O/c1-2-3-9-16-11(12(13,14)15)10-7-5-4-6-8-10/h2,4-8,11H,1,3,9H2 |
| InChIKey | PDAHLPZJDZYXNB-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.23 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|