C11H15F3OSi — CID 11218868
trimethyl-(2,2,2-trifluoro-1-phenylethoxy)silane (PubChem CID 11218868) has the molecular formula C11H15F3OSi and a molecular weight of 248.32 g/mol. Its IUPAC name is trimethyl-(2,2,2-trifluoro-1-phenylethoxy)silane.
| Compound Name | trimethyl-(2,2,2-trifluoro-1-phenylethoxy)silane |
|---|---|
| PubChem CID | 11218868 |
| Molecular Formula | C11H15F3OSi |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | trimethyl-(2,2,2-trifluoro-1-phenylethoxy)silane |
| SMILES | C[Si](C)(C)OC(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C11H15F3OSi/c1-16(2,3)15-10(11(12,13)14)9-7-5-4-6-8-9/h4-8,10H,1-3H3 |
| InChIKey | VRBBWMIFQVYNTK-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|