C22H25F3O4Si — CID 158285953
3-acetylbenzaldehyde;1-[3-(2,2,2-trifluoro-1-trimethylsilyloxyethyl)phenyl]ethanone (PubChem CID 158285953) has the molecular formula C22H25F3O4Si and a molecular weight of 438.52 g/mol. Its IUPAC name is 3-acetylbenzaldehyde;1-[3-(2,2,2-trifluoro-1-trimethylsilyloxyethyl)phenyl]ethanone.
| Compound Name | 3-acetylbenzaldehyde;1-[3-(2,2,2-trifluoro-1-trimethylsilyloxyethyl)phenyl]ethanone |
|---|---|
| PubChem CID | 158285953 |
| Molecular Formula | C22H25F3O4Si |
| Molecular Weight | 438.52 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | 3-acetylbenzaldehyde;1-[3-(2,2,2-trifluoro-1-trimethylsilyloxyethyl)phenyl]ethanone |
| SMILES | CC(=O)c1cccc(C(O[Si](C)(C)C)C(F)(F)F)c1.CC(=O)c1cccc(C=O)c1 |
| InChI | InChI=1S/C13H17F3O2Si.C9H8O2/c1-9(17)10-6-5-7-11(8-10)12(13(14,15)16)18-19(2,3)4;1-7(11)9-4-2-3-8(5-9)6-10/h5-8,12H,1-4H3;2-6H,1H3 |
| InChIKey | GKUADQIFYWVSAI-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.52 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|