C12H12F3NO2 — CID 129412242
N-[(1R)-3,3,3-trifluoro-1-(3-formylphenyl)propyl]acetamide (PubChem CID 129412242) has the molecular formula C12H12F3NO2 and a molecular weight of 259.23 g/mol. Its IUPAC name is N-[(1R)-3,3,3-trifluoro-1-(3-formylphenyl)propyl]acetamide.
| Compound Name | N-[(1R)-3,3,3-trifluoro-1-(3-formylphenyl)propyl]acetamide |
|---|---|
| PubChem CID | 129412242 |
| Molecular Formula | C12H12F3NO2 |
| Molecular Weight | 259.23 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | N-[(1R)-3,3,3-trifluoro-1-(3-formylphenyl)propyl]acetamide |
| SMILES | CC(=O)N[C@H](CC(F)(F)F)c1cccc(C=O)c1 |
| InChI | InChI=1S/C12H12F3NO2/c1-8(18)16-11(6-12(13,14)15)10-4-2-3-9(5-10)7-17/h2-5,7,11H,6H2,1H3,(H,16,18)/t11-/m1/s1 |
| InChIKey | XURAGQLYENHGGG-LLVKDONJSA-N |
| XLogP | 2.63 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.23 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|