C11H11ClF3NO — CID 139194092
N-[(1S)-1-(3-chlorophenyl)-3,3,3-trifluoropropyl]acetamide (PubChem CID 139194092) has the molecular formula C11H11ClF3NO and a molecular weight of 265.66 g/mol. Its IUPAC name is N-[(1S)-1-(3-chlorophenyl)-3,3,3-trifluoropropyl]acetamide.
| Compound Name | N-[(1S)-1-(3-chlorophenyl)-3,3,3-trifluoropropyl]acetamide |
|---|---|
| PubChem CID | 139194092 |
| Molecular Formula | C11H11ClF3NO |
| Molecular Weight | 265.66 g/mol |
| Exact Mass | 265.05 |
| IUPAC Name | N-[(1S)-1-(3-chlorophenyl)-3,3,3-trifluoropropyl]acetamide |
| SMILES | CC(=O)N[C@@H](CC(F)(F)F)c1cccc(Cl)c1 |
| InChI | InChI=1S/C11H11ClF3NO/c1-7(17)16-10(6-11(13,14)15)8-3-2-4-9(12)5-8/h2-5,10H,6H2,1H3,(H,16,17)/t10-/m0/s1 |
| InChIKey | XNEYVSSWGUMWGR-JTQLQIEISA-N |
| XLogP | 3.47 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.66 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |