C11H10Cl2F3NO — CID 124640511
N-[(1R)-1-(2,6-dichlorophenyl)-3,3,3-trifluoropropyl]acetamide (PubChem CID 124640511) has the molecular formula C11H10Cl2F3NO and a molecular weight of 300.11 g/mol. Its IUPAC name is N-[(1R)-1-(2,6-dichlorophenyl)-3,3,3-trifluoropropyl]acetamide.
| Compound Name | N-[(1R)-1-(2,6-dichlorophenyl)-3,3,3-trifluoropropyl]acetamide |
|---|---|
| PubChem CID | 124640511 |
| Molecular Formula | C11H10Cl2F3NO |
| Molecular Weight | 300.11 g/mol |
| Exact Mass | 299.01 |
| IUPAC Name | N-[(1R)-1-(2,6-dichlorophenyl)-3,3,3-trifluoropropyl]acetamide |
| SMILES | CC(=O)N[C@H](CC(F)(F)F)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C11H10Cl2F3NO/c1-6(18)17-9(5-11(14,15)16)10-7(12)3-2-4-8(10)13/h2-4,9H,5H2,1H3,(H,17,18)/t9-/m1/s1 |
| InChIKey | SIQSLNCFKYUIBN-SECBINFHSA-N |
| XLogP | 4.12 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.11 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |