C12H16O2 — CID 115019110
3-(1-hydroxy-2,2-dimethylpropyl)benzaldehyde (PubChem CID 115019110) has the molecular formula C12H16O2 and a molecular weight of 192.26 g/mol. Its IUPAC name is 3-(1-hydroxy-2,2-dimethylpropyl)benzaldehyde.
| Compound Name | 3-(1-hydroxy-2,2-dimethylpropyl)benzaldehyde |
|---|---|
| PubChem CID | 115019110 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | 3-(1-hydroxy-2,2-dimethylpropyl)benzaldehyde |
| SMILES | CC(C)(C)C(O)c1cccc(C=O)c1 |
| InChI | InChI=1S/C12H16O2/c1-12(2,3)11(14)10-6-4-5-9(7-10)8-13/h4-8,11,14H,1-3H3 |
| InChIKey | KDEJXRHUCDJQNK-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|