C13H21NO — CID 105096689
1-[3-(dimethylamino)phenyl]-2,2-dimethylpropan-1-ol (PubChem CID 105096689) has the molecular formula C13H21NO and a molecular weight of 207.32 g/mol. Its IUPAC name is 1-[3-(dimethylamino)phenyl]-2,2-dimethylpropan-1-ol.
| Compound Name | 1-[3-(dimethylamino)phenyl]-2,2-dimethylpropan-1-ol |
|---|---|
| PubChem CID | 105096689 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | 1-[3-(dimethylamino)phenyl]-2,2-dimethylpropan-1-ol |
| SMILES | CN(C)c1cccc(C(O)C(C)(C)C)c1 |
| InChI | InChI=1S/C13H21NO/c1-13(2,3)12(15)10-7-6-8-11(9-10)14(4)5/h6-9,12,15H,1-5H3 |
| InChIKey | KQDLFKMEDYDTFN-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |