C10H18Cl2N2 — CID 53484765
3-[(1R)-1-aminoethyl]-N,N-dimethylaniline;dihydrochloride (PubChem CID 53484765) has the molecular formula C10H18Cl2N2 and a molecular weight of 237.17 g/mol. Its IUPAC name is 3-[(1R)-1-aminoethyl]-N,N-dimethylaniline;dihydrochloride.
| Compound Name | 3-[(1R)-1-aminoethyl]-N,N-dimethylaniline;dihydrochloride |
|---|---|
| PubChem CID | 53484765 |
| Molecular Formula | C10H18Cl2N2 |
| Molecular Weight | 237.17 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | 3-[(1R)-1-aminoethyl]-N,N-dimethylaniline;dihydrochloride |
| SMILES | C[C@@H](N)c1cccc(N(C)C)c1.Cl.Cl |
| InChI | InChI=1S/C10H16N2.2ClH/c1-8(11)9-5-4-6-10(7-9)12(2)3;;/h4-8H,11H2,1-3H3;2*1H/t8-;;/m1../s1 |
| InChIKey | CPXYJZKBXLNXSC-YCBDHFTFSA-N |
| XLogP | 2.62 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.17 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |