C10H9NO3 — CID 171869851
3-(3-formylphenyl)-2,3-dihydroxypropanenitrile (PubChem CID 171869851) has the molecular formula C10H9NO3 and a molecular weight of 191.19 g/mol. Its IUPAC name is 3-(3-formylphenyl)-2,3-dihydroxypropanenitrile.
| Compound Name | 3-(3-formylphenyl)-2,3-dihydroxypropanenitrile |
|---|---|
| PubChem CID | 171869851 |
| Molecular Formula | C10H9NO3 |
| Molecular Weight | 191.19 g/mol |
| Exact Mass | 191.06 |
| IUPAC Name | 3-(3-formylphenyl)-2,3-dihydroxypropanenitrile |
| SMILES | N#CC(O)C(O)c1cccc(C=O)c1 |
| InChI | InChI=1S/C10H9NO3/c11-5-9(13)10(14)8-3-1-2-7(4-8)6-12/h1-4,6,9-10,13-14H |
| InChIKey | AYSWFMBVZMVCKP-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 81.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.19 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'cyanohydrins', 'substructure': 'N/A'} |
|---|