C9H8N2O3 — CID 171870013
3-(6-formyl-2-pyridinyl)-2,3-dihydroxypropanenitrile (PubChem CID 171870013) has the molecular formula C9H8N2O3 and a molecular weight of 192.17 g/mol. Its IUPAC name is 3-(6-formyl-2-pyridinyl)-2,3-dihydroxypropanenitrile.
| Compound Name | 3-(6-formyl-2-pyridinyl)-2,3-dihydroxypropanenitrile |
|---|---|
| PubChem CID | 171870013 |
| Molecular Formula | C9H8N2O3 |
| Molecular Weight | 192.17 g/mol |
| Exact Mass | 192.05 |
| IUPAC Name | 3-(6-formyl-2-pyridinyl)-2,3-dihydroxypropanenitrile |
| SMILES | N#CC(O)C(O)c1cccc(C=O)n1 |
| InChI | InChI=1S/C9H8N2O3/c10-4-8(13)9(14)7-3-1-2-6(5-12)11-7/h1-3,5,8-9,13-14H |
| InChIKey | SNOCQGYQULLRNX-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 94.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.17 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'cyanohydrins', 'substructure': 'N/A'} |
|---|