C11H10N2O2 — CID 171870401
2,3-dihydroxy-3-(1H-indol-7-yl)propanenitrile (PubChem CID 171870401) has the molecular formula C11H10N2O2 and a molecular weight of 202.21 g/mol. Its IUPAC name is 2,3-dihydroxy-3-(1H-indol-7-yl)propanenitrile.
| Compound Name | 2,3-dihydroxy-3-(1H-indol-7-yl)propanenitrile |
|---|---|
| PubChem CID | 171870401 |
| Molecular Formula | C11H10N2O2 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.07 |
| IUPAC Name | 2,3-dihydroxy-3-(1H-indol-7-yl)propanenitrile |
| SMILES | N#CC(O)C(O)c1cccc2cc[nH]c12 |
| InChI | InChI=1S/C11H10N2O2/c12-6-9(14)11(15)8-3-1-2-7-4-5-13-10(7)8/h1-5,9,11,13-15H |
| InChIKey | PIHPYYMFKSZQQW-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'} |
|---|