C9H8INO2 — CID 171871505
2,3-dihydroxy-3-(2-iodophenyl)propanenitrile (PubChem CID 171871505) has the molecular formula C9H8INO2 and a molecular weight of 289.07 g/mol. Its IUPAC name is 2,3-dihydroxy-3-(2-iodophenyl)propanenitrile.
| Compound Name | 2,3-dihydroxy-3-(2-iodophenyl)propanenitrile |
|---|---|
| PubChem CID | 171871505 |
| Molecular Formula | C9H8INO2 |
| Molecular Weight | 289.07 g/mol |
| Exact Mass | 288.96 |
| IUPAC Name | 2,3-dihydroxy-3-(2-iodophenyl)propanenitrile |
| SMILES | N#CC(O)C(O)c1ccccc1I |
| InChI | InChI=1S/C9H8INO2/c10-7-4-2-1-3-6(7)9(13)8(12)5-11/h1-4,8-9,12-13H |
| InChIKey | FZVWDOKDFOICRH-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 64.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.07 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|