C9H8FNO4S — CID 171870545
2-(2-cyano-1,2-dihydroxyethyl)benzenesulfonyl fluoride (PubChem CID 171870545) has the molecular formula C9H8FNO4S and a molecular weight of 245.23 g/mol. Its IUPAC name is 2-(2-cyano-1,2-dihydroxyethyl)benzenesulfonyl fluoride.
| Compound Name | 2-(2-cyano-1,2-dihydroxyethyl)benzenesulfonyl fluoride |
|---|---|
| PubChem CID | 171870545 |
| Molecular Formula | C9H8FNO4S |
| Molecular Weight | 245.23 g/mol |
| Exact Mass | 245.02 |
| IUPAC Name | 2-(2-cyano-1,2-dihydroxyethyl)benzenesulfonyl fluoride |
| SMILES | N#CC(O)C(O)c1ccccc1S(=O)(=O)F |
| InChI | InChI=1S/C9H8FNO4S/c10-16(14,15)8-4-2-1-3-6(8)9(13)7(12)5-11/h1-4,7,9,12-13H |
| InChIKey | QJDHRPHRHWFVCR-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 98.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.23 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'} |
|---|