C10H10N2O3 — CID 171870342
2,3-dihydroxy-3-[2-(hydroxyiminomethyl)phenyl]propanenitrile (PubChem CID 171870342) has the molecular formula C10H10N2O3 and a molecular weight of 206.20 g/mol. Its IUPAC name is 2,3-dihydroxy-3-[2-(hydroxyiminomethyl)phenyl]propanenitrile.
| Compound Name | 2,3-dihydroxy-3-[2-(hydroxyiminomethyl)phenyl]propanenitrile |
|---|---|
| PubChem CID | 171870342 |
| Molecular Formula | C10H10N2O3 |
| Molecular Weight | 206.20 g/mol |
| Exact Mass | 206.07 |
| IUPAC Name | 2,3-dihydroxy-3-[2-(hydroxyiminomethyl)phenyl]propanenitrile |
| SMILES | N#CC(O)C(O)c1ccccc1C=NO |
| InChI | InChI=1S/C10H10N2O3/c11-5-9(13)10(14)8-4-2-1-3-7(8)6-12-15/h1-4,6,9-10,13-15H |
| InChIKey | AAXWHJYTIYBEMQ-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 96.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.20 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|