C9H7FN2O3 — CID 171871356
3-(2-fluoro-3-formyl-4-pyridinyl)-2,3-dihydroxypropanenitrile (PubChem CID 171871356) has the molecular formula C9H7FN2O3 and a molecular weight of 210.16 g/mol. Its IUPAC name is 3-(2-fluoro-3-formyl-4-pyridinyl)-2,3-dihydroxypropanenitrile.
| Compound Name | 3-(2-fluoro-3-formyl-4-pyridinyl)-2,3-dihydroxypropanenitrile |
|---|---|
| PubChem CID | 171871356 |
| Molecular Formula | C9H7FN2O3 |
| Molecular Weight | 210.16 g/mol |
| Exact Mass | 210.04 |
| IUPAC Name | 3-(2-fluoro-3-formyl-4-pyridinyl)-2,3-dihydroxypropanenitrile |
| SMILES | N#CC(O)C(O)c1ccnc(F)c1C=O |
| InChI | InChI=1S/C9H7FN2O3/c10-9-6(4-13)5(1-2-12-9)8(15)7(14)3-11/h1-2,4,7-8,14-15H |
| InChIKey | ULERVHBAXBYTBN-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 94.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.16 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'cyanohydrins', 'substructure': 'N/A'} |
|---|