C10H8ClN3O2 — CID 171871361
3-(4-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)-2,3-dihydroxypropanenitrile (PubChem CID 171871361) has the molecular formula C10H8ClN3O2 and a molecular weight of 237.65 g/mol. Its IUPAC name is 3-(4-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)-2,3-dihydroxypropanenitrile.
| Compound Name | 3-(4-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)-2,3-dihydroxypropanenitrile |
|---|---|
| PubChem CID | 171871361 |
| Molecular Formula | C10H8ClN3O2 |
| Molecular Weight | 237.65 g/mol |
| Exact Mass | 237.03 |
| IUPAC Name | 3-(4-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)-2,3-dihydroxypropanenitrile |
| SMILES | N#CC(O)C(O)c1c[nH]c2nccc(Cl)c12 |
| InChI | InChI=1S/C10H8ClN3O2/c11-6-1-2-13-10-8(6)5(4-14-10)9(16)7(15)3-12/h1-2,4,7,9,15-16H,(H,13,14) |
| InChIKey | GHOTVJINPMPOKD-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.65 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'} |
|---|