C12H18F3NOSi — CID 112548376
3,3,3-trifluoro-1-phenyl-2-trimethylsilyloxypropan-1-amine (PubChem CID 112548376) has the molecular formula C12H18F3NOSi and a molecular weight of 277.36 g/mol. Its IUPAC name is 3,3,3-trifluoro-1-phenyl-2-trimethylsilyloxypropan-1-amine.
| Compound Name | 3,3,3-trifluoro-1-phenyl-2-trimethylsilyloxypropan-1-amine |
|---|---|
| PubChem CID | 112548376 |
| Molecular Formula | C12H18F3NOSi |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 3,3,3-trifluoro-1-phenyl-2-trimethylsilyloxypropan-1-amine |
| SMILES | C[Si](C)(C)OC(C(N)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C12H18F3NOSi/c1-18(2,3)17-11(12(13,14)15)10(16)9-7-5-4-6-8-9/h4-8,10-11H,16H2,1-3H3 |
| InChIKey | YAVZLQBTPNYMSQ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|