C12H12F6O2 — CID 174318334
1,1,1,5,5,5-hexafluoro-4-methoxy-3-phenylpentan-2-ol (PubChem CID 174318334) has the molecular formula C12H12F6O2 and a molecular weight of 302.21 g/mol. Its IUPAC name is 1,1,1,5,5,5-hexafluoro-4-methoxy-3-phenylpentan-2-ol.
| Compound Name | 1,1,1,5,5,5-hexafluoro-4-methoxy-3-phenylpentan-2-ol |
|---|---|
| PubChem CID | 174318334 |
| Molecular Formula | C12H12F6O2 |
| Molecular Weight | 302.21 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | 1,1,1,5,5,5-hexafluoro-4-methoxy-3-phenylpentan-2-ol |
| SMILES | COC(C(c1ccccc1)C(O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H12F6O2/c1-20-10(12(16,17)18)8(9(19)11(13,14)15)7-5-3-2-4-6-7/h2-6,8-10,19H,1H3 |
| InChIKey | ZPXCPIBWAQUDAN-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.21 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |