C12H15F3O3 — CID 139042519
(1R,2S,3R,4S)-5,5,5-trifluoro-4-methyl-1-phenylpentane-1,2,3-triol (PubChem CID 139042519) has the molecular formula C12H15F3O3 and a molecular weight of 264.24 g/mol. Its IUPAC name is (1R,2S,3R,4S)-5,5,5-trifluoro-4-methyl-1-phenylpentane-1,2,3-triol.
| Compound Name | (1R,2S,3R,4S)-5,5,5-trifluoro-4-methyl-1-phenylpentane-1,2,3-triol |
|---|---|
| PubChem CID | 139042519 |
| Molecular Formula | C12H15F3O3 |
| Molecular Weight | 264.24 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | (1R,2S,3R,4S)-5,5,5-trifluoro-4-methyl-1-phenylpentane-1,2,3-triol |
| SMILES | C[C@@H]([C@@H](O)[C@H](O)[C@H](O)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C12H15F3O3/c1-7(12(13,14)15)9(16)11(18)10(17)8-5-3-2-4-6-8/h2-7,9-11,16-18H,1H3/t7-,9+,10+,11-/m0/s1 |
| InChIKey | NIBIOHLZJUHSDG-IANFPDNMSA-N |
| XLogP | 1.64 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.24 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |