C10H10ClF3 — CID 129384644
[(1S,2S)-1-chloro-3,3,3-trifluoro-2-methylpropyl]benzene (PubChem CID 129384644) has the molecular formula C10H10ClF3 and a molecular weight of 222.64 g/mol. Its IUPAC name is [(1S,2S)-1-chloro-3,3,3-trifluoro-2-methylpropyl]benzene.
| Compound Name | [(1S,2S)-1-chloro-3,3,3-trifluoro-2-methylpropyl]benzene |
|---|---|
| PubChem CID | 129384644 |
| Molecular Formula | C10H10ClF3 |
| Molecular Weight | 222.64 g/mol |
| Exact Mass | 222.04 |
| IUPAC Name | [(1S,2S)-1-chloro-3,3,3-trifluoro-2-methylpropyl]benzene |
| SMILES | C[C@H]([C@H](Cl)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C10H10ClF3/c1-7(10(12,13)14)9(11)8-5-3-2-4-6-8/h2-7,9H,1H3/t7-,9+/m1/s1 |
| InChIKey | RQWFJHDXKJDUDW-APPZFPTMSA-N |
| XLogP | 4.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.64 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|