C32H27BClF4N — CID 13400524
1-(1-chloro-1-phenylpropan-2-yl)-2,4,6-triphenylpyridin-1-ium tetrafluoroborate (PubChem CID 13400524) has the molecular formula C32H27BClF4N and a molecular weight of 547.83 g/mol. Its IUPAC name is 1-(1-chloro-1-phenylpropan-2-yl)-2,4,6-triphenylpyridin-1-ium tetrafluoroborate.
| Compound Name | 1-(1-chloro-1-phenylpropan-2-yl)-2,4,6-triphenylpyridin-1-ium tetrafluoroborate |
|---|---|
| PubChem CID | 13400524 |
| Molecular Formula | C32H27BClF4N |
| Molecular Weight | 547.83 g/mol |
| Exact Mass | 547.19 |
| IUPAC Name | 1-(1-chloro-1-phenylpropan-2-yl)-2,4,6-triphenylpyridin-1-ium tetrafluoroborate |
| SMILES | CC(C(Cl)c1ccccc1)[n+]1c(-c2ccccc2)cc(-c2ccccc2)cc1-c1ccccc1.F[B-](F)(F)F |
| InChI | InChI=1S/C32H27ClN.BF4/c1-24(32(33)28-20-12-5-13-21-28)34-30(26-16-8-3-9-17-26)22-29(25-14-6-2-7-15-25)23-31(34)27-18-10-4-11-19-27;2-1(3,4)5/h2-24,32H,1H3;/q+1;-1 |
| InChIKey | QYTDEKOVKDYSII-UHFFFAOYSA-N |
| XLogP | 9.82 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.83 |
| LogP ≤ 5 | 9.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|