C27H24BF4NO2 — CID 12035326
methyl 2-(2,4,6-triphenylpyridin-1-ium-1-yl)propanoate tetrafluoroborate (PubChem CID 12035326) has the molecular formula C27H24BF4NO2 and a molecular weight of 481.30 g/mol. Its IUPAC name is methyl 2-(2,4,6-triphenylpyridin-1-ium-1-yl)propanoate tetrafluoroborate.
| Compound Name | methyl 2-(2,4,6-triphenylpyridin-1-ium-1-yl)propanoate tetrafluoroborate |
|---|---|
| PubChem CID | 12035326 |
| Molecular Formula | C27H24BF4NO2 |
| Molecular Weight | 481.30 g/mol |
| Exact Mass | 481.18 |
| IUPAC Name | methyl 2-(2,4,6-triphenylpyridin-1-ium-1-yl)propanoate tetrafluoroborate |
| SMILES | COC(=O)C(C)[n+]1c(-c2ccccc2)cc(-c2ccccc2)cc1-c1ccccc1.F[B-](F)(F)F |
| InChI | InChI=1S/C27H24NO2.BF4/c1-20(27(29)30-2)28-25(22-14-8-4-9-15-22)18-24(21-12-6-3-7-13-21)19-26(28)23-16-10-5-11-17-23;2-1(3,4)5/h3-20H,1-2H3;/q+1;-1 |
| InChIKey | PRWWWVVJHOVJBG-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.30 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|