C27H24NO2+ — CID 3657877
2-(2,4,6-triphenylpyridin-1-ium-1-yl)ethyl acetate (PubChem CID 3657877) has the molecular formula C27H24NO2+ and a molecular weight of 394.49 g/mol. Its IUPAC name is 2-(2,4,6-triphenylpyridin-1-ium-1-yl)ethyl acetate.
| Compound Name | 2-(2,4,6-triphenylpyridin-1-ium-1-yl)ethyl acetate |
|---|---|
| PubChem CID | 3657877 |
| Molecular Formula | C27H24NO2+ |
| Molecular Weight | 394.49 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | 2-(2,4,6-triphenylpyridin-1-ium-1-yl)ethyl acetate |
| SMILES | CC(=O)OCC[n+]1c(-c2ccccc2)cc(-c2ccccc2)cc1-c1ccccc1 |
| InChI | InChI=1S/C27H24NO2/c1-21(29)30-18-17-28-26(23-13-7-3-8-14-23)19-25(22-11-5-2-6-12-22)20-27(28)24-15-9-4-10-16-24/h2-16,19-20H,17-18H2,1H3/q+1 |
| InChIKey | HLUAZEGAGONKFG-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.49 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|