C30H28ClNO8 — CID 11813766
[2-acetyloxy-3-(2,4,6-triphenylpyridin-1-ium-1-yl)propyl] acetate perchlorate (PubChem CID 11813766) has the molecular formula C30H28ClNO8 and a molecular weight of 566.01 g/mol. Its IUPAC name is [2-acetyloxy-3-(2,4,6-triphenylpyridin-1-ium-1-yl)propyl] acetate perchlorate.
| Compound Name | [2-acetyloxy-3-(2,4,6-triphenylpyridin-1-ium-1-yl)propyl] acetate perchlorate |
|---|---|
| PubChem CID | 11813766 |
| Molecular Formula | C30H28ClNO8 |
| Molecular Weight | 566.01 g/mol |
| Exact Mass | 565.15 |
| IUPAC Name | [2-acetyloxy-3-(2,4,6-triphenylpyridin-1-ium-1-yl)propyl] acetate perchlorate |
| SMILES | CC(=O)OCC(C[n+]1c(-c2ccccc2)cc(-c2ccccc2)cc1-c1ccccc1)OC(C)=O.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C30H28NO4.ClHO4/c1-22(32)34-21-28(35-23(2)33)20-31-29(25-14-8-4-9-15-25)18-27(24-12-6-3-7-13-24)19-30(31)26-16-10-5-11-17-26;2-1(3,4)5/h3-19,28H,20-21H2,1-2H3;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | LIGDEKOJQYZJPP-UHFFFAOYSA-M |
| XLogP | 0.71 |
| TPSA | 148.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.01 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|