About [2-acetyloxy-3-(2,4,6-trimethylpyridin-1-ium-1-yl)propyl] acetate
[2-acetyloxy-3-(2,4,6-trimethylpyridin-1-ium-1-yl)propyl] acetate (PubChem CID 11111678) has the molecular formula C15H22NO4+
and a molecular weight of 280.34 g/mol. Its IUPAC name is [2-acetyloxy-3-(2,4,6-trimethylpyridin-1-ium-1-yl)propyl] acetate.
Molecular Properties
| Compound Name | [2-acetyloxy-3-(2,4,6-trimethylpyridin-1-ium-1-yl)propyl] acetate |
| PubChem CID | 11111678 |
| Molecular Formula | C15H22NO4+ |
| Molecular Weight | 280.34 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | [2-acetyloxy-3-(2,4,6-trimethylpyridin-1-ium-1-yl)propyl] acetate |
| SMILES | CC(=O)OCC(C[n+]1c(C)cc(C)cc1C)OC(C)=O |
| InChI | InChI=1S/C15H22NO4/c1-10-6-11(2)16(12(3)7-10)8-15(20-14(5)18)9-19-13(4)17/h6-7,15H,8-9H2,1-5H3/q+1 |
| InChIKey | ZBWBRTGBNOXSFC-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 56.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.34 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze [2-acetyloxy-3-(2,4,6-trimethylpyridin-1-ium-1-yl)propyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-acetyloxy-3-(2,4,6-trimethylpyridin-1-ium-1-yl)propyl] acetate?
The IUPAC name of [2-acetyloxy-3-(2,4,6-trimethylpyridin-1-ium-1-yl)propyl] acetate (CID 11111678) is [2-acetyloxy-3-(2,4,6-trimethylpyridin-1-ium-1-yl)propyl] acetate.
What is the SMILES notation for [2-acetyloxy-3-(2,4,6-trimethylpyridin-1-ium-1-yl)propyl] acetate?
The canonical SMILES for [2-acetyloxy-3-(2,4,6-trimethylpyridin-1-ium-1-yl)propyl] acetate is CC(=O)OCC(C[n+]1c(C)cc(C)cc1C)OC(C)=O.
What is the InChIKey of [2-acetyloxy-3-(2,4,6-trimethylpyridin-1-ium-1-yl)propyl] acetate?
The InChIKey is ZBWBRTGBNOXSFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22NO4/c1-10-6-11(2)16(12(3)7-10)8-15(20-14(5)18)9-19-13(4)17/h6-7,15H,8-9H2,1-5H3/q+1.
What are the key properties of [2-acetyloxy-3-(2,4,6-trimethylpyridin-1-ium-1-yl)propyl] acetate?
[2-acetyloxy-3-(2,4,6-trimethylpyridin-1-ium-1-yl)propyl] acetate has a molecular weight of 280.34 g/mol, XLogP of 1.39, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-acetyloxy-3-(2,4,6-trimethylpyridin-1-ium-1-yl)propyl] acetate is sourced from PubChem (CID 11111678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).